C6H6F4N2 — CID 15310731
5-methyl-3-(1,1,2,2-tetrafluoroethyl)-1H-pyrazole (PubChem CID 15310731) has the molecular formula C6H6F4N2 and a molecular weight of 182.12 g/mol. Its IUPAC name is 5-methyl-3-(1,1,2,2-tetrafluoroethyl)-1H-pyrazole.
| Compound Name | 5-methyl-3-(1,1,2,2-tetrafluoroethyl)-1H-pyrazole |
|---|---|
| PubChem CID | 15310731 |
| Molecular Formula | C6H6F4N2 |
| Molecular Weight | 182.12 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | 5-methyl-3-(1,1,2,2-tetrafluoroethyl)-1H-pyrazole |
| SMILES | Cc1cc(C(F)(F)C(F)F)n[nH]1 |
| InChI | InChI=1S/C6H6F4N2/c1-3-2-4(12-11-3)6(9,10)5(7)8/h2,5H,1H3,(H,11,12) |
| InChIKey | QUBWTEDNHUCBBT-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.12 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|