About CID 153110136
CID 153110136 (PubChem CID 153110136) has the molecular formula C29H39F3N4O4Si-
and a molecular weight of 592.74 g/mol.
Molecular Properties
| Compound Name | CID 153110136 |
| PubChem CID | 153110136 |
| Molecular Formula | C29H39F3N4O4Si- |
| Molecular Weight | 592.74 g/mol |
| Exact Mass | 592.27 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC(=O)C(C)(C)COc1ccc(-c2ccc(-c3nc(C(F)(F)F)n(COCC[Si-](C)(C)C)n3)cn2)cc1 |
| InChI | InChI=1S/C29H39F3N4O4Si/c1-27(2,3)40-26(37)28(4,5)18-39-22-12-9-20(10-13-22)23-14-11-21(17-33-23)24-34-25(29(30,31)32)36(35-24)19-38-15-16-41(6,7)8/h9-14,17H,15-16,18-19H2,1-8H3/q-1 |
| InChIKey | NQBHMLOLDYLLAS-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 88.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 592.74 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 153110136 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 153110136?
The IUPAC name of CID 153110136 (CID 153110136) is not available.
What is the SMILES notation for CID 153110136?
The canonical SMILES for CID 153110136 is CC(C)(C)OC(=O)C(C)(C)COc1ccc(-c2ccc(-c3nc(C(F)(F)F)n(COCC[Si-](C)(C)C)n3)cn2)cc1.
What is the InChIKey of CID 153110136?
The InChIKey is NQBHMLOLDYLLAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H39F3N4O4Si/c1-27(2,3)40-26(37)28(4,5)18-39-22-12-9-20(10-13-22)23-14-11-21(17-33-23)24-34-25(29(30,31)32)36(35-24)19-38-15-16-41(6,7)8/h9-14,17H,15-16,18-19H2,1-8H3/q-1.
What are the key properties of CID 153110136?
CID 153110136 has a molecular weight of 592.74 g/mol, XLogP of 7.08, 11 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 153110136 is sourced from PubChem (CID 153110136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).