trimethylsilyl 5,5-dimethyl-N-phenylhexa-2,3-dienimidate

C17H25NOSi — CID 15311350

IUPACtrimethylsilyl 5,5-dimethyl-N-phenylhexa-2,3-dienimidate
SMILESCC(C)(C)C=C=C/C(=N/c1ccccc1)O[Si](C)(C)C
InChIInChI=1S/C17H25NOSi/c1-17(2,3)14-10-13-16(19-20(4,5)6)18-15-11-8-7-9-12-15/h7-9,11-14H,1-6H3/b18-16-
InChIKeyPAIGKRBDMWCFCK-VLGSPTGOSA-N
MW287.48 g/mol
LogP5.33
Rot. Bonds3

About trimethylsilyl 5,5-dimethyl-N-phenylhexa-2,3-dienimidate

trimethylsilyl 5,5-dimethyl-N-phenylhexa-2,3-dienimidate (PubChem CID 15311350) has the molecular formula C17H25NOSi and a molecular weight of 287.48 g/mol. Its IUPAC name is trimethylsilyl 5,5-dimethyl-N-phenylhexa-2,3-dienimidate.

Molecular Properties

Compound Nametrimethylsilyl 5,5-dimethyl-N-phenylhexa-2,3-dienimidate
PubChem CID15311350
Molecular FormulaC17H25NOSi
Molecular Weight287.48 g/mol
Exact Mass287.17
IUPAC Nametrimethylsilyl 5,5-dimethyl-N-phenylhexa-2,3-dienimidate
SMILESCC(C)(C)C=C=C/C(=N/c1ccccc1)O[Si](C)(C)C
InChIInChI=1S/C17H25NOSi/c1-17(2,3)14-10-13-16(19-20(4,5)6)18-15-11-8-7-9-12-15/h7-9,11-14H,1-6H3/b18-16-
InChIKeyPAIGKRBDMWCFCK-VLGSPTGOSA-N
XLogP5.33
TPSA21.59 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms20
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500287.48
LogP ≤ 55.33
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}

Analyze trimethylsilyl 5,5-dimethyl-N-phenylhexa-2,3-dienimidate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of trimethylsilyl 5,5-dimethyl-N-phenylhexa-2,3-dienimidate?
The IUPAC name of trimethylsilyl 5,5-dimethyl-N-phenylhexa-2,3-dienimidate (CID 15311350) is trimethylsilyl 5,5-dimethyl-N-phenylhexa-2,3-dienimidate.
What is the SMILES notation for trimethylsilyl 5,5-dimethyl-N-phenylhexa-2,3-dienimidate?
The canonical SMILES for trimethylsilyl 5,5-dimethyl-N-phenylhexa-2,3-dienimidate is CC(C)(C)C=C=C/C(=N/c1ccccc1)O[Si](C)(C)C.
What is the InChIKey of trimethylsilyl 5,5-dimethyl-N-phenylhexa-2,3-dienimidate?
The InChIKey is PAIGKRBDMWCFCK-VLGSPTGOSA-N. The full InChI is InChI=1S/C17H25NOSi/c1-17(2,3)14-10-13-16(19-20(4,5)6)18-15-11-8-7-9-12-15/h7-9,11-14H,1-6H3/b18-16-.
What are the key properties of trimethylsilyl 5,5-dimethyl-N-phenylhexa-2,3-dienimidate?
trimethylsilyl 5,5-dimethyl-N-phenylhexa-2,3-dienimidate has a molecular weight of 287.48 g/mol, XLogP of 5.33, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trimethylsilyl 5,5-dimethyl-N-phenylhexa-2,3-dienimidate is sourced from PubChem (CID 15311350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).