About 3-amino-4-ethyl-1H-1,2,4-triazol-5-one
3-amino-4-ethyl-1H-1,2,4-triazol-5-one (PubChem CID 153114196) has the molecular formula C4H8N4O
and a molecular weight of 128.13 g/mol. Its IUPAC name is 3-amino-4-ethyl-1H-1,2,4-triazol-5-one.
Molecular Properties
| Compound Name | 3-amino-4-ethyl-1H-1,2,4-triazol-5-one |
| PubChem CID | 153114196 |
| Molecular Formula | C4H8N4O |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.07 |
| IUPAC Name | 3-amino-4-ethyl-1H-1,2,4-triazol-5-one |
| SMILES | CCn1c(N)n[nH]c1=O |
| InChI | InChI=1S/C4H8N4O/c1-2-8-3(5)6-7-4(8)9/h2H2,1H3,(H2,5,6)(H,7,9) |
| InChIKey | VTNOBWOXQCHLMV-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 76.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-4-ethyl-1H-1,2,4-triazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4-ethyl-1H-1,2,4-triazol-5-one?
The IUPAC name of 3-amino-4-ethyl-1H-1,2,4-triazol-5-one (CID 153114196) is 3-amino-4-ethyl-1H-1,2,4-triazol-5-one.
What is the SMILES notation for 3-amino-4-ethyl-1H-1,2,4-triazol-5-one?
The canonical SMILES for 3-amino-4-ethyl-1H-1,2,4-triazol-5-one is CCn1c(N)n[nH]c1=O.
What is the InChIKey of 3-amino-4-ethyl-1H-1,2,4-triazol-5-one?
The InChIKey is VTNOBWOXQCHLMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N4O/c1-2-8-3(5)6-7-4(8)9/h2H2,1H3,(H2,5,6)(H,7,9).
What are the key properties of 3-amino-4-ethyl-1H-1,2,4-triazol-5-one?
3-amino-4-ethyl-1H-1,2,4-triazol-5-one has a molecular weight of 128.13 g/mol, XLogP of -0.83, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4-ethyl-1H-1,2,4-triazol-5-one is sourced from PubChem (CID 153114196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).