C16H18BrFN6O4S — CID 153114252
N'-(3-bromo-4-fluorophenyl)-4-[(1-cyclopropylsulfonylazetidin-3-yl)methylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 153114252) has the molecular formula C16H18BrFN6O4S and a molecular weight of 489.33 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-4-[(1-cyclopropylsulfonylazetidin-3-yl)methylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-4-[(1-cyclopropylsulfonylazetidin-3-yl)methylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 153114252 |
| Molecular Formula | C16H18BrFN6O4S |
| Molecular Weight | 489.33 g/mol |
| Exact Mass | 488.03 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-4-[(1-cyclopropylsulfonylazetidin-3-yl)methylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | O=S(=O)(C1CC1)N1CC(CNc2nonc2/C(=N/c2ccc(F)c(Br)c2)NO)C1 |
| InChI | InChI=1S/C16H18BrFN6O4S/c17-12-5-10(1-4-13(12)18)20-16(21-25)14-15(23-28-22-14)19-6-9-7-24(8-9)29(26,27)11-2-3-11/h1,4-5,9,11,25H,2-3,6-8H2,(H,19,23)(H,20,21) |
| InChIKey | VTNVHDVJLPWXMQ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 132.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.33 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|