About methyl 2-(cyanomethyl)butanoate
methyl 2-(cyanomethyl)butanoate (PubChem CID 15312095) has the molecular formula C7H11NO2
and a molecular weight of 141.17 g/mol. Its IUPAC name is methyl 2-(cyanomethyl)butanoate.
Molecular Properties
| Compound Name | methyl 2-(cyanomethyl)butanoate |
| PubChem CID | 15312095 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | methyl 2-(cyanomethyl)butanoate |
| SMILES | CCC(CC#N)C(=O)OC |
| InChI | InChI=1S/C7H11NO2/c1-3-6(4-5-8)7(9)10-2/h6H,3-4H2,1-2H3 |
| InChIKey | SAWIETIIGXNKKO-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-(cyanomethyl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(cyanomethyl)butanoate?
The IUPAC name of methyl 2-(cyanomethyl)butanoate (CID 15312095) is methyl 2-(cyanomethyl)butanoate.
What is the SMILES notation for methyl 2-(cyanomethyl)butanoate?
The canonical SMILES for methyl 2-(cyanomethyl)butanoate is CCC(CC#N)C(=O)OC.
What is the InChIKey of methyl 2-(cyanomethyl)butanoate?
The InChIKey is SAWIETIIGXNKKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2/c1-3-6(4-5-8)7(9)10-2/h6H,3-4H2,1-2H3.
What are the key properties of methyl 2-(cyanomethyl)butanoate?
methyl 2-(cyanomethyl)butanoate has a molecular weight of 141.17 g/mol, XLogP of 1.10, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(cyanomethyl)butanoate is sourced from PubChem (CID 15312095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).