C16H21F3OS2Si — CID 15312186
[6-benzylsulfanyl-6-(trifluoromethyl)-2,5-dihydrothiopyran-2-yl]oxy-trimethylsilane (PubChem CID 15312186) has the molecular formula C16H21F3OS2Si and a molecular weight of 378.56 g/mol. Its IUPAC name is [6-benzylsulfanyl-6-(trifluoromethyl)-2,5-dihydrothiopyran-2-yl]oxy-trimethylsilane.
| Compound Name | [6-benzylsulfanyl-6-(trifluoromethyl)-2,5-dihydrothiopyran-2-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 15312186 |
| Molecular Formula | C16H21F3OS2Si |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | [6-benzylsulfanyl-6-(trifluoromethyl)-2,5-dihydrothiopyran-2-yl]oxy-trimethylsilane |
| SMILES | C[Si](C)(C)OC1C=CCC(SCc2ccccc2)(C(F)(F)F)S1 |
| InChI | InChI=1S/C16H21F3OS2Si/c1-23(2,3)20-14-10-7-11-15(22-14,16(17,18)19)21-12-13-8-5-4-6-9-13/h4-10,14H,11-12H2,1-3H3 |
| InChIKey | LXUNVQQETUICNK-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|