C12H14F8OS2 — CID 15312188
6-(1,1,2,2,3,3,4,4-octafluorobutyl)-6-propylsulfanyl-2,5-dihydrothiopyran-5-ol (PubChem CID 15312188) has the molecular formula C12H14F8OS2 and a molecular weight of 390.36 g/mol. Its IUPAC name is 6-(1,1,2,2,3,3,4,4-octafluorobutyl)-6-propylsulfanyl-2,5-dihydrothiopyran-5-ol.
| Compound Name | 6-(1,1,2,2,3,3,4,4-octafluorobutyl)-6-propylsulfanyl-2,5-dihydrothiopyran-5-ol |
|---|---|
| PubChem CID | 15312188 |
| Molecular Formula | C12H14F8OS2 |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | 6-(1,1,2,2,3,3,4,4-octafluorobutyl)-6-propylsulfanyl-2,5-dihydrothiopyran-5-ol |
| SMILES | CCCSC1(C(F)(F)C(F)(F)C(F)(F)C(F)F)SCC=CC1O |
| InChI | InChI=1S/C12H14F8OS2/c1-2-5-22-10(7(21)4-3-6-23-10)12(19,20)11(17,18)9(15,16)8(13)14/h3-4,7-8,21H,2,5-6H2,1H3 |
| InChIKey | QMLQFEDRKAYGBL-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|