C8H3ClF8N2 — CID 15312428
4-chloro-2-methyl-6-(1,1,2,2,2-pentafluoroethyl)-5-(trifluoromethyl)pyrimidine (PubChem CID 15312428) has the molecular formula C8H3ClF8N2 and a molecular weight of 314.56 g/mol. Its IUPAC name is 4-chloro-2-methyl-6-(1,1,2,2,2-pentafluoroethyl)-5-(trifluoromethyl)pyrimidine.
| Compound Name | 4-chloro-2-methyl-6-(1,1,2,2,2-pentafluoroethyl)-5-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 15312428 |
| Molecular Formula | C8H3ClF8N2 |
| Molecular Weight | 314.56 g/mol |
| Exact Mass | 313.99 |
| IUPAC Name | 4-chloro-2-methyl-6-(1,1,2,2,2-pentafluoroethyl)-5-(trifluoromethyl)pyrimidine |
| SMILES | Cc1nc(Cl)c(C(F)(F)F)c(C(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C8H3ClF8N2/c1-2-18-4(6(10,11)8(15,16)17)3(5(9)19-2)7(12,13)14/h1H3 |
| InChIKey | IXVKNTRFWDQRRW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.56 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|