About 2,5-dipentyl-1,3,4-oxadiazole
2,5-dipentyl-1,3,4-oxadiazole (PubChem CID 15312529) has the molecular formula C12H22N2O
and a molecular weight of 210.32 g/mol. Its IUPAC name is 2,5-dipentyl-1,3,4-oxadiazole.
Molecular Properties
| Compound Name | 2,5-dipentyl-1,3,4-oxadiazole |
| PubChem CID | 15312529 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | 2,5-dipentyl-1,3,4-oxadiazole |
| SMILES | CCCCCc1nnc(CCCCC)o1 |
| InChI | InChI=1S/C12H22N2O/c1-3-5-7-9-11-13-14-12(15-11)10-8-6-4-2/h3-10H2,1-2H3 |
| InChIKey | YHSAOGDMLDJGPA-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dipentyl-1,3,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dipentyl-1,3,4-oxadiazole?
The IUPAC name of 2,5-dipentyl-1,3,4-oxadiazole (CID 15312529) is 2,5-dipentyl-1,3,4-oxadiazole.
What is the SMILES notation for 2,5-dipentyl-1,3,4-oxadiazole?
The canonical SMILES for 2,5-dipentyl-1,3,4-oxadiazole is CCCCCc1nnc(CCCCC)o1.
What is the InChIKey of 2,5-dipentyl-1,3,4-oxadiazole?
The InChIKey is YHSAOGDMLDJGPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O/c1-3-5-7-9-11-13-14-12(15-11)10-8-6-4-2/h3-10H2,1-2H3.
What are the key properties of 2,5-dipentyl-1,3,4-oxadiazole?
2,5-dipentyl-1,3,4-oxadiazole has a molecular weight of 210.32 g/mol, XLogP of 3.54, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dipentyl-1,3,4-oxadiazole is sourced from PubChem (CID 15312529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).