C36H45F2N3O4S — CID 153129224
(3S,4R)-3-amino-1-[2-[2-[(2S,6R)-1-(benzenesulfonyl)-6-methylpiperazin-2-yl]ethyl]-3-fluorophenyl]-4-[(2R,6S)-2,6-dimethyloxan-4-yl]-4-(4-fluorophenyl)butan-2-one (PubChem CID 153129224) has the molecular formula C36H45F2N3O4S and a molecular weight of 653.84 g/mol. Its IUPAC name is (3S,4R)-3-amino-1-[2-[2-[(2S,6R)-1-(benzenesulfonyl)-6-methylpiperazin-2-yl]ethyl]-3-fluorophenyl]-4-[(2R,6S)-2,6-dimethyloxan-4-yl]-4-(4-fluorophenyl)butan-2-one.
| Compound Name | (3S,4R)-3-amino-1-[2-[2-[(2S,6R)-1-(benzenesulfonyl)-6-methylpiperazin-2-yl]ethyl]-3-fluorophenyl]-4-[(2R,6S)-2,6-dimethyloxan-4-yl]-4-(4-fluorophenyl)butan-2-one |
|---|---|
| PubChem CID | 153129224 |
| Molecular Formula | C36H45F2N3O4S |
| Molecular Weight | 653.84 g/mol |
| Exact Mass | 653.31 |
| IUPAC Name | (3S,4R)-3-amino-1-[2-[2-[(2S,6R)-1-(benzenesulfonyl)-6-methylpiperazin-2-yl]ethyl]-3-fluorophenyl]-4-[(2R,6S)-2,6-dimethyloxan-4-yl]-4-(4-fluorophenyl)butan-2-one |
| SMILES | C[C@@H]1CC([C@H](c2ccc(F)cc2)[C@H](N)C(=O)Cc2cccc(F)c2CC[C@H]2CNC[C@@H](C)N2S(=O)(=O)c2ccccc2)C[C@H](C)O1 |
| InChI | InChI=1S/C36H45F2N3O4S/c1-23-21-40-22-30(41(23)46(43,44)31-9-5-4-6-10-31)16-17-32-27(8-7-11-33(32)38)20-34(42)36(39)35(26-12-14-29(37)15-13-26)28-18-24(2)45-25(3)19-28/h4-15,23-25,28,30,35-36,40H,16-22,39H2,1-3H3/t23-,24-,25+,28?,30+,35+,36-/m1/s1 |
| InChIKey | VWKCEYYOOLLNMT-ORCCEZOLSA-N |
| XLogP | 5.37 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.84 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |