About 2,2,3-tritert-butyloxirane
2,2,3-tritert-butyloxirane (PubChem CID 15313217) has the molecular formula C14H28O
and a molecular weight of 212.38 g/mol. Its IUPAC name is 2,2,3-tritert-butyloxirane.
Molecular Properties
| Compound Name | 2,2,3-tritert-butyloxirane |
| PubChem CID | 15313217 |
| Molecular Formula | C14H28O |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.21 |
| IUPAC Name | 2,2,3-tritert-butyloxirane |
| SMILES | CC(C)(C)C1OC1(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H28O/c1-11(2,3)10-14(15-10,12(4,5)6)13(7,8)9/h10H,1-9H3 |
| InChIKey | YIFYGXKYBFDHOW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2,2,3-tritert-butyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,3-tritert-butyloxirane?
The IUPAC name of 2,2,3-tritert-butyloxirane (CID 15313217) is 2,2,3-tritert-butyloxirane.
What is the SMILES notation for 2,2,3-tritert-butyloxirane?
The canonical SMILES for 2,2,3-tritert-butyloxirane is CC(C)(C)C1OC1(C(C)(C)C)C(C)(C)C.
What is the InChIKey of 2,2,3-tritert-butyloxirane?
The InChIKey is YIFYGXKYBFDHOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O/c1-11(2,3)10-14(15-10,12(4,5)6)13(7,8)9/h10H,1-9H3.
What are the key properties of 2,2,3-tritert-butyloxirane?
2,2,3-tritert-butyloxirane has a molecular weight of 212.38 g/mol, XLogP of 4.26, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,3-tritert-butyloxirane is sourced from PubChem (CID 15313217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).