C23H26N6O4S — CID 153132854
15-(oxan-4-yl)-8-oxo-8λ4-thia-5,11,14,15,18,24-hexazatetracyclo[18.3.1.12,5.013,17]pentacosa-1(24),2(25),3,13,16,20,22-heptaene-12,19-dione (PubChem CID 153132854) has the molecular formula C23H26N6O4S and a molecular weight of 482.57 g/mol. Its IUPAC name is 15-(oxan-4-yl)-8-oxo-8λ4-thia-5,11,14,15,18,24-hexazatetracyclo[18.3.1.12,5.013,17]pentacosa-1(24),2(25),3,13,16,20,22-heptaene-12,19-dione.
| Compound Name | 15-(oxan-4-yl)-8-oxo-8λ4-thia-5,11,14,15,18,24-hexazatetracyclo[18.3.1.12,5.013,17]pentacosa-1(24),2(25),3,13,16,20,22-heptaene-12,19-dione |
|---|---|
| PubChem CID | 153132854 |
| Molecular Formula | C23H26N6O4S |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | 15-(oxan-4-yl)-8-oxo-8λ4-thia-5,11,14,15,18,24-hexazatetracyclo[18.3.1.12,5.013,17]pentacosa-1(24),2(25),3,13,16,20,22-heptaene-12,19-dione |
| SMILES | O=C1Nc2cn(C3CCOCC3)nc2C(=O)NCCS(=O)CCn2ccc(c2)-c2cccc1n2 |
| InChI | InChI=1S/C23H26N6O4S/c30-22-19-3-1-2-18(25-19)16-4-8-28(14-16)9-13-34(32)12-7-24-23(31)21-20(26-22)15-29(27-21)17-5-10-33-11-6-17/h1-4,8,14-15,17H,5-7,9-13H2,(H,24,31)(H,26,30) |
| InChIKey | VXBUFWQNCCDBAK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 120.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |