C11H18N4O2 — CID 153137216
1,3,7-trimethyl-8-propan-2-yl-4,5-dihydropurine-2,6-dione (PubChem CID 153137216) has the molecular formula C11H18N4O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is 1,3,7-trimethyl-8-propan-2-yl-4,5-dihydropurine-2,6-dione.
| Compound Name | 1,3,7-trimethyl-8-propan-2-yl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 153137216 |
| Molecular Formula | C11H18N4O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 1,3,7-trimethyl-8-propan-2-yl-4,5-dihydropurine-2,6-dione |
| SMILES | CC(C)C1=NC2C(C(=O)N(C)C(=O)N2C)N1C |
| InChI | InChI=1S/C11H18N4O2/c1-6(2)8-12-9-7(13(8)3)10(16)15(5)11(17)14(9)4/h6-7,9H,1-5H3 |
| InChIKey | VXXJLHJMKPTPFA-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |