C22H28O2 — CID 153141221
[4-[3-[(2S)-2-(3-methoxyphenyl)propyl]cyclopentyl]phenyl]methanol (PubChem CID 153141221) has the molecular formula C22H28O2 and a molecular weight of 324.46 g/mol. Its IUPAC name is [4-[3-[(2S)-2-(3-methoxyphenyl)propyl]cyclopentyl]phenyl]methanol.
| Compound Name | [4-[3-[(2S)-2-(3-methoxyphenyl)propyl]cyclopentyl]phenyl]methanol |
|---|---|
| PubChem CID | 153141221 |
| Molecular Formula | C22H28O2 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | [4-[3-[(2S)-2-(3-methoxyphenyl)propyl]cyclopentyl]phenyl]methanol |
| SMILES | COc1cccc([C@@H](C)CC2CCC(c3ccc(CO)cc3)C2)c1 |
| InChI | InChI=1S/C22H28O2/c1-16(20-4-3-5-22(14-20)24-2)12-18-8-11-21(13-18)19-9-6-17(15-23)7-10-19/h3-7,9-10,14,16,18,21,23H,8,11-13,15H2,1-2H3/t16-,18?,21?/m0/s1 |
| InChIKey | VYQUIKVNKPSLMH-AFJQURTJSA-N |
| XLogP | 5.26 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |