C17H16O3S — CID 15314170
cis-(2S,3S)-2-(benzenesulfonyl)-3-phenylcyclopentan-1-one (PubChem CID 15314170) has the molecular formula C17H16O3S and a molecular weight of 300.38 g/mol. Its IUPAC name is cis-(2S,3S)-2-(benzenesulfonyl)-3-phenylcyclopentan-1-one.
| Compound Name | cis-(2S,3S)-2-(benzenesulfonyl)-3-phenylcyclopentan-1-one |
|---|---|
| PubChem CID | 15314170 |
| Molecular Formula | C17H16O3S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | cis-(2S,3S)-2-(benzenesulfonyl)-3-phenylcyclopentan-1-one |
| SMILES | O=C1CC[C@@H](c2ccccc2)[C@@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H16O3S/c18-16-12-11-15(13-7-3-1-4-8-13)17(16)21(19,20)14-9-5-2-6-10-14/h1-10,15,17H,11-12H2/t15-,17-/m0/s1 |
| InChIKey | SWRBRFQUYWMPEY-RDJZCZTQSA-N |
| XLogP | 2.98 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |