About trans-(2S,3S)-2-(benzenesulfonyl)-3-benzylcyclopentan-1-one
trans-(2S,3S)-2-(benzenesulfonyl)-3-benzylcyclopentan-1-one (PubChem CID 15314172) has the molecular formula C18H18O3S
and a molecular weight of 314.41 g/mol. Its IUPAC name is trans-(2S,3S)-2-(benzenesulfonyl)-3-benzylcyclopentan-1-one.
Molecular Properties
| Compound Name | trans-(2S,3S)-2-(benzenesulfonyl)-3-benzylcyclopentan-1-one |
| PubChem CID | 15314172 |
| Molecular Formula | C18H18O3S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | trans-(2S,3S)-2-(benzenesulfonyl)-3-benzylcyclopentan-1-one |
| SMILES | O=C1CC[C@@H](Cc2ccccc2)[C@@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H18O3S/c19-17-12-11-15(13-14-7-3-1-4-8-14)18(17)22(20,21)16-9-5-2-6-10-16/h1-10,15,18H,11-13H2/t15-,18-/m0/s1 |
| InChIKey | YGXVMULHUWCQKM-YJBOKZPZSA-N |
| XLogP | 3.05 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze trans-(2S,3S)-2-(benzenesulfonyl)-3-benzylcyclopentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(2S,3S)-2-(benzenesulfonyl)-3-benzylcyclopentan-1-one?
The IUPAC name of trans-(2S,3S)-2-(benzenesulfonyl)-3-benzylcyclopentan-1-one (CID 15314172) is trans-(2S,3S)-2-(benzenesulfonyl)-3-benzylcyclopentan-1-one.
What is the SMILES notation for trans-(2S,3S)-2-(benzenesulfonyl)-3-benzylcyclopentan-1-one?
The canonical SMILES for trans-(2S,3S)-2-(benzenesulfonyl)-3-benzylcyclopentan-1-one is O=C1CC[C@@H](Cc2ccccc2)[C@@H]1S(=O)(=O)c1ccccc1.
What is the InChIKey of trans-(2S,3S)-2-(benzenesulfonyl)-3-benzylcyclopentan-1-one?
The InChIKey is YGXVMULHUWCQKM-YJBOKZPZSA-N. The full InChI is InChI=1S/C18H18O3S/c19-17-12-11-15(13-14-7-3-1-4-8-14)18(17)22(20,21)16-9-5-2-6-10-16/h1-10,15,18H,11-13H2/t15-,18-/m0/s1.
What are the key properties of trans-(2S,3S)-2-(benzenesulfonyl)-3-benzylcyclopentan-1-one?
trans-(2S,3S)-2-(benzenesulfonyl)-3-benzylcyclopentan-1-one has a molecular weight of 314.41 g/mol, XLogP of 3.05, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(2S,3S)-2-(benzenesulfonyl)-3-benzylcyclopentan-1-one is sourced from PubChem (CID 15314172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).