C13H22O4 — CID 15314581
5-[2-(3-hydroxypent-4-enyl)-1,3-dioxolan-2-yl]pent-1-en-3-ol (PubChem CID 15314581) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is 5-[2-(3-hydroxypent-4-enyl)-1,3-dioxolan-2-yl]pent-1-en-3-ol.
| Compound Name | 5-[2-(3-hydroxypent-4-enyl)-1,3-dioxolan-2-yl]pent-1-en-3-ol |
|---|---|
| PubChem CID | 15314581 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 5-[2-(3-hydroxypent-4-enyl)-1,3-dioxolan-2-yl]pent-1-en-3-ol |
| SMILES | C=CC(O)CCC1(CCC(O)C=C)OCCO1 |
| InChI | InChI=1S/C13H22O4/c1-3-11(14)5-7-13(16-9-10-17-13)8-6-12(15)4-2/h3-4,11-12,14-15H,1-2,5-10H2 |
| InChIKey | XRNZEGWMAAVOLG-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|