About (1,1-diethoxy-3,4-diphenyl-5-trimethylsilylsilol-2-yl)-trimethylsilane
(1,1-diethoxy-3,4-diphenyl-5-trimethylsilylsilol-2-yl)-trimethylsilane (PubChem CID 15314701) has the molecular formula C26H38O2Si3
and a molecular weight of 466.85 g/mol. Its IUPAC name is (1,1-diethoxy-3,4-diphenyl-5-trimethylsilylsilol-2-yl)-trimethylsilane.
Molecular Properties
| Compound Name | (1,1-diethoxy-3,4-diphenyl-5-trimethylsilylsilol-2-yl)-trimethylsilane |
| PubChem CID | 15314701 |
| Molecular Formula | C26H38O2Si3 |
| Molecular Weight | 466.85 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | (1,1-diethoxy-3,4-diphenyl-5-trimethylsilylsilol-2-yl)-trimethylsilane |
| SMILES | CCO[Si]1(OCC)C([Si](C)(C)C)=C(c2ccccc2)C(c2ccccc2)=C1[Si](C)(C)C |
| InChI | InChI=1S/C26H38O2Si3/c1-9-27-31(28-10-2)25(29(3,4)5)23(21-17-13-11-14-18-21)24(26(31)30(6,7)8)22-19-15-12-16-20-22/h11-20H,9-10H2,1-8H3 |
| InChIKey | UGOOODYNBXAEMU-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.85 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (1,1-diethoxy-3,4-diphenyl-5-trimethylsilylsilol-2-yl)-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,1-diethoxy-3,4-diphenyl-5-trimethylsilylsilol-2-yl)-trimethylsilane?
The IUPAC name of (1,1-diethoxy-3,4-diphenyl-5-trimethylsilylsilol-2-yl)-trimethylsilane (CID 15314701) is (1,1-diethoxy-3,4-diphenyl-5-trimethylsilylsilol-2-yl)-trimethylsilane.
What is the SMILES notation for (1,1-diethoxy-3,4-diphenyl-5-trimethylsilylsilol-2-yl)-trimethylsilane?
The canonical SMILES for (1,1-diethoxy-3,4-diphenyl-5-trimethylsilylsilol-2-yl)-trimethylsilane is CCO[Si]1(OCC)C([Si](C)(C)C)=C(c2ccccc2)C(c2ccccc2)=C1[Si](C)(C)C.
What is the InChIKey of (1,1-diethoxy-3,4-diphenyl-5-trimethylsilylsilol-2-yl)-trimethylsilane?
The InChIKey is UGOOODYNBXAEMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H38O2Si3/c1-9-27-31(28-10-2)25(29(3,4)5)23(21-17-13-11-14-18-21)24(26(31)30(6,7)8)22-19-15-12-16-20-22/h11-20H,9-10H2,1-8H3.
What are the key properties of (1,1-diethoxy-3,4-diphenyl-5-trimethylsilylsilol-2-yl)-trimethylsilane?
(1,1-diethoxy-3,4-diphenyl-5-trimethylsilylsilol-2-yl)-trimethylsilane has a molecular weight of 466.85 g/mol, XLogP of 7.26, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1,1-diethoxy-3,4-diphenyl-5-trimethylsilylsilol-2-yl)-trimethylsilane is sourced from PubChem (CID 15314701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).