C27H22F2N2O2 — CID 153152379
(3S)-4-[4-fluoro-6-(4-fluorophenyl)indol-1-yl]-3-hydroxy-1-(4-isocyano-3-methylphenyl)-3-methylbutan-2-one (PubChem CID 153152379) has the molecular formula C27H22F2N2O2 and a molecular weight of 444.48 g/mol. Its IUPAC name is (3S)-4-[4-fluoro-6-(4-fluorophenyl)indol-1-yl]-3-hydroxy-1-(4-isocyano-3-methylphenyl)-3-methylbutan-2-one.
| Compound Name | (3S)-4-[4-fluoro-6-(4-fluorophenyl)indol-1-yl]-3-hydroxy-1-(4-isocyano-3-methylphenyl)-3-methylbutan-2-one |
|---|---|
| PubChem CID | 153152379 |
| Molecular Formula | C27H22F2N2O2 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | (3S)-4-[4-fluoro-6-(4-fluorophenyl)indol-1-yl]-3-hydroxy-1-(4-isocyano-3-methylphenyl)-3-methylbutan-2-one |
| SMILES | [C-]#[N+]c1ccc(CC(=O)[C@@](C)(O)Cn2ccc3c(F)cc(-c4ccc(F)cc4)cc32)cc1C |
| InChI | InChI=1S/C27H22F2N2O2/c1-17-12-18(4-9-24(17)30-3)13-26(32)27(2,33)16-31-11-10-22-23(29)14-20(15-25(22)31)19-5-7-21(28)8-6-19/h4-12,14-15,33H,13,16H2,1-2H3/t27-/m0/s1 |
| InChIKey | WASWHBKUCWWEIM-MHZLTWQESA-N |
| XLogP | 6.01 |
| TPSA | 46.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|