C26H26F3N5O — CID 153152566
2-[4-[(3S)-3-aminopiperidin-1-yl]-5,6,7,8-tetrahydro-1,8-naphthyridin-3-yl]-1-[6-(2,6-difluorophenyl)-5-fluoro-2-pyridinyl]ethanone (PubChem CID 153152566) has the molecular formula C26H26F3N5O and a molecular weight of 481.52 g/mol. Its IUPAC name is 2-[4-[(3S)-3-aminopiperidin-1-yl]-5,6,7,8-tetrahydro-1,8-naphthyridin-3-yl]-1-[6-(2,6-difluorophenyl)-5-fluoro-2-pyridinyl]ethanone.
| Compound Name | 2-[4-[(3S)-3-aminopiperidin-1-yl]-5,6,7,8-tetrahydro-1,8-naphthyridin-3-yl]-1-[6-(2,6-difluorophenyl)-5-fluoro-2-pyridinyl]ethanone |
|---|---|
| PubChem CID | 153152566 |
| Molecular Formula | C26H26F3N5O |
| Molecular Weight | 481.52 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | 2-[4-[(3S)-3-aminopiperidin-1-yl]-5,6,7,8-tetrahydro-1,8-naphthyridin-3-yl]-1-[6-(2,6-difluorophenyl)-5-fluoro-2-pyridinyl]ethanone |
| SMILES | N[C@H]1CCCN(c2c(CC(=O)c3ccc(F)c(-c4c(F)cccc4F)n3)cnc3c2CCCN3)C1 |
| InChI | InChI=1S/C26H26F3N5O/c27-18-6-1-7-19(28)23(18)24-20(29)8-9-21(33-24)22(35)12-15-13-32-26-17(5-2-10-31-26)25(15)34-11-3-4-16(30)14-34/h1,6-9,13,16H,2-5,10-12,14,30H2,(H,31,32)/t16-/m0/s1 |
| InChIKey | WATQSIKVXTYYMN-INIZCTEOSA-N |
| XLogP | 4.27 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.52 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |