C26H40O2 — CID 15315307
2-[(1E,6E)-3-tert-butyl-2,6-dimethyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-1,3,4,6-tetraenyl]-1,3-dioxolane (PubChem CID 15315307) has the molecular formula C26H40O2 and a molecular weight of 384.60 g/mol. Its IUPAC name is 2-[(1E,6E)-3-tert-butyl-2,6-dimethyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-1,3,4,6-tetraenyl]-1,3-dioxolane.
| Compound Name | 2-[(1E,6E)-3-tert-butyl-2,6-dimethyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-1,3,4,6-tetraenyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 15315307 |
| Molecular Formula | C26H40O2 |
| Molecular Weight | 384.60 g/mol |
| Exact Mass | 384.30 |
| IUPAC Name | 2-[(1E,6E)-3-tert-butyl-2,6-dimethyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-1,3,4,6-tetraenyl]-1,3-dioxolane |
| SMILES | CC1=C(C/C=C(\C)C=C=C(/C(C)=C/C2OCCO2)C(C)(C)C)C(C)(C)CCC1 |
| InChI | InChI=1S/C26H40O2/c1-19(12-14-23-20(2)10-9-15-26(23,7)8)11-13-22(25(4,5)6)21(3)18-24-27-16-17-28-24/h11-12,18,24H,9-10,14-17H2,1-8H3/b19-12+,21-18+ |
| InChIKey | KAFDNXKPGICRTR-RXSHZQOHSA-N |
| XLogP | 7.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.60 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|