C27H27N5O5 — CID 153153533
N-[4-(3-anilino-6-nitrocarbonyl-4-oxo-1,5,6,7-tetrahydroindol-2-yl)-2-pyridinyl]-2,2-dimethylpent-4-enamide (PubChem CID 153153533) has the molecular formula C27H27N5O5 and a molecular weight of 501.54 g/mol. Its IUPAC name is N-[4-(3-anilino-6-nitrocarbonyl-4-oxo-1,5,6,7-tetrahydroindol-2-yl)-2-pyridinyl]-2,2-dimethylpent-4-enamide.
| Compound Name | N-[4-(3-anilino-6-nitrocarbonyl-4-oxo-1,5,6,7-tetrahydroindol-2-yl)-2-pyridinyl]-2,2-dimethylpent-4-enamide |
|---|---|
| PubChem CID | 153153533 |
| Molecular Formula | C27H27N5O5 |
| Molecular Weight | 501.54 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | N-[4-(3-anilino-6-nitrocarbonyl-4-oxo-1,5,6,7-tetrahydroindol-2-yl)-2-pyridinyl]-2,2-dimethylpent-4-enamide |
| SMILES | C=CCC(C)(C)C(=O)Nc1cc(-c2[nH]c3c(c2Nc2ccccc2)C(=O)CC(C(=O)[N+](=O)[O-])C3)ccn1 |
| InChI | InChI=1S/C27H27N5O5/c1-4-11-27(2,3)26(35)31-21-15-16(10-12-28-21)23-24(29-18-8-6-5-7-9-18)22-19(30-23)13-17(14-20(22)33)25(34)32(36)37/h4-10,12,15,17,29-30H,1,11,13-14H2,2-3H3,(H,28,31,35) |
| InChIKey | WAYJNXKXXGTHMP-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 147.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.54 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|