C14H18O4 — CID 15315369
1-[(3aR,8aR,8bR)-2,2,6-trimethyl-3a,8,8a,8b-tetrahydro-[1,3]dioxolo[4,5-b][1]benzofuran-7-yl]ethanone (PubChem CID 15315369) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is 1-[(3aR,8aR,8bR)-2,2,6-trimethyl-3a,8,8a,8b-tetrahydro-[1,3]dioxolo[4,5-b][1]benzofuran-7-yl]ethanone.
| Compound Name | 1-[(3aR,8aR,8bR)-2,2,6-trimethyl-3a,8,8a,8b-tetrahydro-[1,3]dioxolo[4,5-b][1]benzofuran-7-yl]ethanone |
|---|---|
| PubChem CID | 15315369 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 1-[(3aR,8aR,8bR)-2,2,6-trimethyl-3a,8,8a,8b-tetrahydro-[1,3]dioxolo[4,5-b][1]benzofuran-7-yl]ethanone |
| SMILES | CC(=O)C1=C(C)C=C2O[C@@H]3OC(C)(C)O[C@@H]3[C@H]2C1 |
| InChI | InChI=1S/C14H18O4/c1-7-5-11-10(6-9(7)8(2)15)12-13(16-11)18-14(3,4)17-12/h5,10,12-13H,6H2,1-4H3/t10-,12+,13+/m0/s1 |
| InChIKey | OOMFMNCBNWWFCP-CYZMBNFOSA-N |
| XLogP | 2.30 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |