About 4-thiophen-2-yl-N,N-bis(4-thiophen-2-ylphenyl)aniline
4-thiophen-2-yl-N,N-bis(4-thiophen-2-ylphenyl)aniline (PubChem CID 15315428) has the molecular formula C30H21NS3
and a molecular weight of 491.71 g/mol. Its IUPAC name is 4-thiophen-2-yl-N,N-bis(4-thiophen-2-ylphenyl)aniline.
Molecular Properties
| Compound Name | 4-thiophen-2-yl-N,N-bis(4-thiophen-2-ylphenyl)aniline |
| PubChem CID | 15315428 |
| Molecular Formula | C30H21NS3 |
| Molecular Weight | 491.71 g/mol |
| Exact Mass | 491.08 |
| IUPAC Name | 4-thiophen-2-yl-N,N-bis(4-thiophen-2-ylphenyl)aniline |
| SMILES | c1csc(-c2ccc(N(c3ccc(-c4cccs4)cc3)c3ccc(-c4cccs4)cc3)cc2)c1 |
| InChI | InChI=1S/C30H21NS3/c1-4-28(32-19-1)22-7-13-25(14-8-22)31(26-15-9-23(10-16-26)29-5-2-20-33-29)27-17-11-24(12-18-27)30-6-3-21-34-30/h1-21H |
| InChIKey | DXPFPUHRRPAXAO-UHFFFAOYSA-N |
| XLogP | 10.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 491.71 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-thiophen-2-yl-N,N-bis(4-thiophen-2-ylphenyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-thiophen-2-yl-N,N-bis(4-thiophen-2-ylphenyl)aniline?
The IUPAC name of 4-thiophen-2-yl-N,N-bis(4-thiophen-2-ylphenyl)aniline (CID 15315428) is 4-thiophen-2-yl-N,N-bis(4-thiophen-2-ylphenyl)aniline.
What is the SMILES notation for 4-thiophen-2-yl-N,N-bis(4-thiophen-2-ylphenyl)aniline?
The canonical SMILES for 4-thiophen-2-yl-N,N-bis(4-thiophen-2-ylphenyl)aniline is c1csc(-c2ccc(N(c3ccc(-c4cccs4)cc3)c3ccc(-c4cccs4)cc3)cc2)c1.
What is the InChIKey of 4-thiophen-2-yl-N,N-bis(4-thiophen-2-ylphenyl)aniline?
The InChIKey is DXPFPUHRRPAXAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H21NS3/c1-4-28(32-19-1)22-7-13-25(14-8-22)31(26-15-9-23(10-16-26)29-5-2-20-33-29)27-17-11-24(12-18-27)30-6-3-21-34-30/h1-21H.
What are the key properties of 4-thiophen-2-yl-N,N-bis(4-thiophen-2-ylphenyl)aniline?
4-thiophen-2-yl-N,N-bis(4-thiophen-2-ylphenyl)aniline has a molecular weight of 491.71 g/mol, XLogP of 10.34, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-thiophen-2-yl-N,N-bis(4-thiophen-2-ylphenyl)aniline is sourced from PubChem (CID 15315428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).