C15H26IN — CID 15315502
(2R,6S)-2,3,4,5,6-pentadeuterio-1,1-dimethyl-2,6-bis(2-methylprop-2-enyl)-3H-pyridin-1-ium iodide (PubChem CID 15315502) has the molecular formula C15H26IN and a molecular weight of 352.31 g/mol. Its IUPAC name is (2R,6S)-2,3,4,5,6-pentadeuterio-1,1-dimethyl-2,6-bis(2-methylprop-2-enyl)-3H-pyridin-1-ium iodide.
| Compound Name | (2R,6S)-2,3,4,5,6-pentadeuterio-1,1-dimethyl-2,6-bis(2-methylprop-2-enyl)-3H-pyridin-1-ium iodide |
|---|---|
| PubChem CID | 15315502 |
| Molecular Formula | C15H26IN |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | (2R,6S)-2,3,4,5,6-pentadeuterio-1,1-dimethyl-2,6-bis(2-methylprop-2-enyl)-3H-pyridin-1-ium iodide |
| SMILES | [2H]C1=C([2H])[C@]([2H])(CC(=C)C)[N+](C)(C)[C@@]([2H])(CC(=C)C)C1[2H].[I-] |
| InChI | InChI=1S/C15H26N.HI/c1-12(2)10-14-8-7-9-15(11-13(3)4)16(14,5)6;/h7-8,14-15H,1,3,9-11H2,2,4-6H3;1H/q+1;/p-1/t14-,15-;/m1./s1/i7D,8D,9D,14D,15D;/t9?,14-,15-; |
| InChIKey | DLABOMSVRDWFSW-OWTANWRPSA-M |
| XLogP | 0.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|