About (E)-1-cyclohexylidene-N,N-diethylhept-2-en-1-amine
(E)-1-cyclohexylidene-N,N-diethylhept-2-en-1-amine (PubChem CID 15315666) has the molecular formula C17H31N
and a molecular weight of 249.44 g/mol. Its IUPAC name is (E)-1-cyclohexylidene-N,N-diethylhept-2-en-1-amine.
Molecular Properties
| Compound Name | (E)-1-cyclohexylidene-N,N-diethylhept-2-en-1-amine |
| PubChem CID | 15315666 |
| Molecular Formula | C17H31N |
| Molecular Weight | 249.44 g/mol |
| Exact Mass | 249.25 |
| IUPAC Name | (E)-1-cyclohexylidene-N,N-diethylhept-2-en-1-amine |
| SMILES | CCCC/C=C/C(=C1CCCCC1)N(CC)CC |
| InChI | InChI=1S/C17H31N/c1-4-7-8-12-15-17(18(5-2)6-3)16-13-10-9-11-14-16/h12,15H,4-11,13-14H2,1-3H3/b15-12+ |
| InChIKey | GMDIYCSFESSLME-NTCAYCPXSA-N |
| XLogP | 5.29 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 249.44 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-cyclohexylidene-N,N-diethylhept-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-cyclohexylidene-N,N-diethylhept-2-en-1-amine?
The IUPAC name of (E)-1-cyclohexylidene-N,N-diethylhept-2-en-1-amine (CID 15315666) is (E)-1-cyclohexylidene-N,N-diethylhept-2-en-1-amine.
What is the SMILES notation for (E)-1-cyclohexylidene-N,N-diethylhept-2-en-1-amine?
The canonical SMILES for (E)-1-cyclohexylidene-N,N-diethylhept-2-en-1-amine is CCCC/C=C/C(=C1CCCCC1)N(CC)CC.
What is the InChIKey of (E)-1-cyclohexylidene-N,N-diethylhept-2-en-1-amine?
The InChIKey is GMDIYCSFESSLME-NTCAYCPXSA-N. The full InChI is InChI=1S/C17H31N/c1-4-7-8-12-15-17(18(5-2)6-3)16-13-10-9-11-14-16/h12,15H,4-11,13-14H2,1-3H3/b15-12+.
What are the key properties of (E)-1-cyclohexylidene-N,N-diethylhept-2-en-1-amine?
(E)-1-cyclohexylidene-N,N-diethylhept-2-en-1-amine has a molecular weight of 249.44 g/mol, XLogP of 5.29, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-cyclohexylidene-N,N-diethylhept-2-en-1-amine is sourced from PubChem (CID 15315666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).