C7H10F4N2O — CID 15316139
N,1-dimethyl-3-(1,1,2,2-tetrafluoroethyl)aziridine-2-carboxamide (PubChem CID 15316139) has the molecular formula C7H10F4N2O and a molecular weight of 214.16 g/mol. Its IUPAC name is N,1-dimethyl-3-(1,1,2,2-tetrafluoroethyl)aziridine-2-carboxamide.
| Compound Name | N,1-dimethyl-3-(1,1,2,2-tetrafluoroethyl)aziridine-2-carboxamide |
|---|---|
| PubChem CID | 15316139 |
| Molecular Formula | C7H10F4N2O |
| Molecular Weight | 214.16 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | N,1-dimethyl-3-(1,1,2,2-tetrafluoroethyl)aziridine-2-carboxamide |
| SMILES | CNC(=O)C1C(C(F)(F)C(F)F)N1C |
| InChI | InChI=1S/C7H10F4N2O/c1-12-5(14)3-4(13(3)2)7(10,11)6(8)9/h3-4,6H,1-2H3,(H,12,14) |
| InChIKey | JALLWRHMHHCSCL-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 32.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.16 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|