C14H17NO6S2 — CID 153162387
2-acetamido-3-[2-(4-methylsulfanylphenyl)acetyl]peroxysulfanylpropanoic acid (PubChem CID 153162387) has the molecular formula C14H17NO6S2 and a molecular weight of 359.43 g/mol. Its IUPAC name is 2-acetamido-3-[2-(4-methylsulfanylphenyl)acetyl]peroxysulfanylpropanoic acid.
| Compound Name | 2-acetamido-3-[2-(4-methylsulfanylphenyl)acetyl]peroxysulfanylpropanoic acid |
|---|---|
| PubChem CID | 153162387 |
| Molecular Formula | C14H17NO6S2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | 2-acetamido-3-[2-(4-methylsulfanylphenyl)acetyl]peroxysulfanylpropanoic acid |
| SMILES | CSc1ccc(CC(=O)OOSCC(NC(C)=O)C(=O)O)cc1 |
| InChI | InChI=1S/C14H17NO6S2/c1-9(16)15-12(14(18)19)8-23-21-20-13(17)7-10-3-5-11(22-2)6-4-10/h3-6,12H,7-8H2,1-2H3,(H,15,16)(H,18,19) |
| InChIKey | WCPJTDWQIDBMLE-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|