C14H16O3S2 — CID 15316291
(1S,2S,7S,8R)-2-methoxy-4,5-bis(methylsulfanyl)tricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione (PubChem CID 15316291) has the molecular formula C14H16O3S2 and a molecular weight of 296.41 g/mol. Its IUPAC name is (1S,2S,7S,8R)-2-methoxy-4,5-bis(methylsulfanyl)tricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione.
| Compound Name | (1S,2S,7S,8R)-2-methoxy-4,5-bis(methylsulfanyl)tricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione |
|---|---|
| PubChem CID | 15316291 |
| Molecular Formula | C14H16O3S2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | (1S,2S,7S,8R)-2-methoxy-4,5-bis(methylsulfanyl)tricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione |
| SMILES | CO[C@]12C(=O)C(SC)=C(SC)C(=O)[C@H]1[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C14H16O3S2/c1-17-14-8-5-4-7(6-8)9(14)10(15)11(18-2)12(19-3)13(14)16/h4-5,7-9H,6H2,1-3H3/t7-,8+,9+,14-/m0/s1 |
| InChIKey | AVPBRTGXSWESJV-HZFYHNGZSA-N |
| XLogP | 2.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|