C14H15NO4S2 — CID 15316292
(1S,2R,7S,8R)-4,5-bis(methylsulfanyl)-2-(nitromethyl)tricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione (PubChem CID 15316292) has the molecular formula C14H15NO4S2 and a molecular weight of 325.41 g/mol. Its IUPAC name is (1S,2R,7S,8R)-4,5-bis(methylsulfanyl)-2-(nitromethyl)tricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione.
| Compound Name | (1S,2R,7S,8R)-4,5-bis(methylsulfanyl)-2-(nitromethyl)tricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione |
|---|---|
| PubChem CID | 15316292 |
| Molecular Formula | C14H15NO4S2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | (1S,2R,7S,8R)-4,5-bis(methylsulfanyl)-2-(nitromethyl)tricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione |
| SMILES | CSC1=C(SC)C(=O)[C@]2(C[N+](=O)[O-])[C@@H]3C=C[C@@H](C3)[C@@H]2C1=O |
| InChI | InChI=1S/C14H15NO4S2/c1-20-11-10(16)9-7-3-4-8(5-7)14(9,6-15(18)19)13(17)12(11)21-2/h3-4,7-9H,5-6H2,1-2H3/t7-,8+,9+,14+/m0/s1 |
| InChIKey | GLTWPKOCVJKGAO-FSEIGPPCSA-N |
| XLogP | 2.16 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|