C22H27NO7S2 — CID 15316293
diethyl 2-acetamido-2-[(1S,2R,7S,8R)-4,5-bis(methylsulfanyl)-3,6-dioxo-2-tricyclo[6.2.1.02,7]undeca-4,9-dienyl]propanedioate (PubChem CID 15316293) has the molecular formula C22H27NO7S2 and a molecular weight of 481.59 g/mol. Its IUPAC name is diethyl 2-acetamido-2-[(1S,2R,7S,8R)-4,5-bis(methylsulfanyl)-3,6-dioxo-2-tricyclo[6.2.1.02,7]undeca-4,9-dienyl]propanedioate.
| Compound Name | diethyl 2-acetamido-2-[(1S,2R,7S,8R)-4,5-bis(methylsulfanyl)-3,6-dioxo-2-tricyclo[6.2.1.02,7]undeca-4,9-dienyl]propanedioate |
|---|---|
| PubChem CID | 15316293 |
| Molecular Formula | C22H27NO7S2 |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.12 |
| IUPAC Name | diethyl 2-acetamido-2-[(1S,2R,7S,8R)-4,5-bis(methylsulfanyl)-3,6-dioxo-2-tricyclo[6.2.1.02,7]undeca-4,9-dienyl]propanedioate |
| SMILES | CCOC(=O)C(NC(C)=O)(C(=O)OCC)[C@]12C(=O)C(SC)=C(SC)C(=O)[C@H]1[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C22H27NO7S2/c1-6-29-19(27)22(23-11(3)24,20(28)30-7-2)21-13-9-8-12(10-13)14(21)15(25)16(31-4)17(32-5)18(21)26/h8-9,12-14H,6-7,10H2,1-5H3,(H,23,24)/t12-,13+,14+,21-/m0/s1 |
| InChIKey | VQUFKSNJMMMYHB-JLOINQRVSA-N |
| XLogP | 1.89 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|