C46H33N3S — CID 153165521
24-[4-[2-[(2E,4Z,6Z)-octa-2,4,6-trien-2-yl]-6-pyridin-2-yl-4-pyridinyl]phenyl]-3-thia-24-azahexacyclo[15.7.0.02,10.04,9.011,16.018,23]tetracosa-1(17),2(10),4,6,8,11,13,15,18,20,22-undecaene (PubChem CID 153165521) has the molecular formula C46H33N3S and a molecular weight of 659.86 g/mol. Its IUPAC name is 24-[4-[2-[(2E,4Z,6Z)-octa-2,4,6-trien-2-yl]-6-pyridin-2-yl-4-pyridinyl]phenyl]-3-thia-24-azahexacyclo[15.7.0.02,10.04,9.011,16.018,23]tetracosa-1(17),2(10),4,6,8,11,13,15,18,20,22-undecaene.
| Compound Name | 24-[4-[2-[(2E,4Z,6Z)-octa-2,4,6-trien-2-yl]-6-pyridin-2-yl-4-pyridinyl]phenyl]-3-thia-24-azahexacyclo[15.7.0.02,10.04,9.011,16.018,23]tetracosa-1(17),2(10),4,6,8,11,13,15,18,20,22-undecaene |
|---|---|
| PubChem CID | 153165521 |
| Molecular Formula | C46H33N3S |
| Molecular Weight | 659.86 g/mol |
| Exact Mass | 659.24 |
| IUPAC Name | 24-[4-[2-[(2E,4Z,6Z)-octa-2,4,6-trien-2-yl]-6-pyridin-2-yl-4-pyridinyl]phenyl]-3-thia-24-azahexacyclo[15.7.0.02,10.04,9.011,16.018,23]tetracosa-1(17),2(10),4,6,8,11,13,15,18,20,22-undecaene |
| SMILES | C/C=C\C=C/C=C(\C)c1cc(-c2ccc(-n3c4ccccc4c4c5ccccc5c5c6ccccc6sc5c43)cc2)cc(-c2ccccn2)n1 |
| InChI | InChI=1S/C46H33N3S/c1-3-4-5-6-15-30(2)39-28-32(29-40(48-39)38-20-13-14-27-47-38)31-23-25-33(26-24-31)49-41-21-11-9-18-36(41)43-34-16-7-8-17-35(34)44-37-19-10-12-22-42(37)50-46(44)45(43)49/h3-29H,1-2H3/b4-3-,6-5-,30-15+ |
| InChIKey | WDEJEFOXMLIKJE-RRQFIVPDSA-N |
| XLogP | 12.96 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.86 |
| LogP ≤ 5 | 12.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|