C24H32ClN3O2 — CID 153166870
8-chloro-5,5-dimethyl-1'-[2-(2-methylimidazol-1-yl)ethyl]spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine] (PubChem CID 153166870) has the molecular formula C24H32ClN3O2 and a molecular weight of 429.99 g/mol. Its IUPAC name is 8-chloro-5,5-dimethyl-1'-[2-(2-methylimidazol-1-yl)ethyl]spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine].
| Compound Name | 8-chloro-5,5-dimethyl-1'-[2-(2-methylimidazol-1-yl)ethyl]spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine] |
|---|---|
| PubChem CID | 153166870 |
| Molecular Formula | C24H32ClN3O2 |
| Molecular Weight | 429.99 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | 8-chloro-5,5-dimethyl-1'-[2-(2-methylimidazol-1-yl)ethyl]spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine] |
| SMILES | Cc1nccn1CCN1CCC2(CC1)COC1c3ccc(Cl)cc3OC(C)(C)C1C2 |
| InChI | InChI=1S/C24H32ClN3O2/c1-17-26-8-11-28(17)13-12-27-9-6-24(7-10-27)15-20-22(29-16-24)19-5-4-18(25)14-21(19)30-23(20,2)3/h4-5,8,11,14,20,22H,6-7,9-10,12-13,15-16H2,1-3H3 |
| InChIKey | WDLBYQOAVJSWSI-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.99 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |