C15H24O3 — CID 15316943
2-tert-butyl-4-tert-butylperoxy-4-methylcyclohexa-2,5-dien-1-one (PubChem CID 15316943) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is 2-tert-butyl-4-tert-butylperoxy-4-methylcyclohexa-2,5-dien-1-one.
| Compound Name | 2-tert-butyl-4-tert-butylperoxy-4-methylcyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 15316943 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 2-tert-butyl-4-tert-butylperoxy-4-methylcyclohexa-2,5-dien-1-one |
| SMILES | CC(C)(C)OOC1(C)C=CC(=O)C(C(C)(C)C)=C1 |
| InChI | InChI=1S/C15H24O3/c1-13(2,3)11-10-15(7,9-8-12(11)16)18-17-14(4,5)6/h8-10H,1-7H3 |
| InChIKey | XAIPWZBJAWEARG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|