C20H23NO3 — CID 15317164
ethyl 2-[(3S,5S)-2-methyl-3,5-diphenyl-1,2-oxazolidin-3-yl]acetate (PubChem CID 15317164) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is ethyl 2-[(3S,5S)-2-methyl-3,5-diphenyl-1,2-oxazolidin-3-yl]acetate.
| Compound Name | ethyl 2-[(3S,5S)-2-methyl-3,5-diphenyl-1,2-oxazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 15317164 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | ethyl 2-[(3S,5S)-2-methyl-3,5-diphenyl-1,2-oxazolidin-3-yl]acetate |
| SMILES | CCOC(=O)C[C@]1(c2ccccc2)C[C@@H](c2ccccc2)ON1C |
| InChI | InChI=1S/C20H23NO3/c1-3-23-19(22)15-20(17-12-8-5-9-13-17)14-18(24-21(20)2)16-10-6-4-7-11-16/h4-13,18H,3,14-15H2,1-2H3/t18-,20-/m0/s1 |
| InChIKey | DNTURUNMEMDLTF-ICSRJNTNSA-N |
| XLogP | 3.84 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |