C29H24BrN3S — CID 15317882
2-[(3R,3aR,7E)-7-benzylidene-3-phenyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-4-(4-bromophenyl)-1,3-thiazole (PubChem CID 15317882) has the molecular formula C29H24BrN3S and a molecular weight of 526.50 g/mol. Its IUPAC name is 2-[(3R,3aR,7E)-7-benzylidene-3-phenyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-4-(4-bromophenyl)-1,3-thiazole.
| Compound Name | 2-[(3R,3aR,7E)-7-benzylidene-3-phenyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-4-(4-bromophenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 15317882 |
| Molecular Formula | C29H24BrN3S |
| Molecular Weight | 526.50 g/mol |
| Exact Mass | 525.09 |
| IUPAC Name | 2-[(3R,3aR,7E)-7-benzylidene-3-phenyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-4-(4-bromophenyl)-1,3-thiazole |
| SMILES | Brc1ccc(-c2csc(N3N=C4/C(=C/c5ccccc5)CCC[C@@H]4[C@@H]3c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C29H24BrN3S/c30-24-16-14-21(15-17-24)26-19-34-29(31-26)33-28(22-10-5-2-6-11-22)25-13-7-12-23(27(25)32-33)18-20-8-3-1-4-9-20/h1-6,8-11,14-19,25,28H,7,12-13H2/b23-18+/t25-,28-/m0/s1 |
| InChIKey | XVNZJHOGCZZYMJ-YSFILUDLSA-N |
| XLogP | 8.37 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.50 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |