About (Z)-1-(3,3-difluoro-1-propan-2-ylcyclobutyl)-N'-methylethene-1,2-diamine
(Z)-1-(3,3-difluoro-1-propan-2-ylcyclobutyl)-N'-methylethene-1,2-diamine (PubChem CID 153188643) has the molecular formula C10H18F2N2
and a molecular weight of 204.26 g/mol. Its IUPAC name is (Z)-1-(3,3-difluoro-1-propan-2-ylcyclobutyl)-N'-methylethene-1,2-diamine.
Molecular Properties
| Compound Name | (Z)-1-(3,3-difluoro-1-propan-2-ylcyclobutyl)-N'-methylethene-1,2-diamine |
| PubChem CID | 153188643 |
| Molecular Formula | C10H18F2N2 |
| Molecular Weight | 204.26 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | (Z)-1-(3,3-difluoro-1-propan-2-ylcyclobutyl)-N'-methylethene-1,2-diamine |
| SMILES | CN/C=C(\N)C1(C(C)C)CC(F)(F)C1 |
| InChI | InChI=1S/C10H18F2N2/c1-7(2)9(8(13)4-14-3)5-10(11,12)6-9/h4,7,14H,5-6,13H2,1-3H3/b8-4- |
| InChIKey | WHOUHJFFACOGLS-YWEYNIOJSA-N |
| XLogP | 2.08 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.26 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (Z)-1-(3,3-difluoro-1-propan-2-ylcyclobutyl)-N'-methylethene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-(3,3-difluoro-1-propan-2-ylcyclobutyl)-N'-methylethene-1,2-diamine?
The IUPAC name of (Z)-1-(3,3-difluoro-1-propan-2-ylcyclobutyl)-N'-methylethene-1,2-diamine (CID 153188643) is (Z)-1-(3,3-difluoro-1-propan-2-ylcyclobutyl)-N'-methylethene-1,2-diamine.
What is the SMILES notation for (Z)-1-(3,3-difluoro-1-propan-2-ylcyclobutyl)-N'-methylethene-1,2-diamine?
The canonical SMILES for (Z)-1-(3,3-difluoro-1-propan-2-ylcyclobutyl)-N'-methylethene-1,2-diamine is CN/C=C(\N)C1(C(C)C)CC(F)(F)C1.
What is the InChIKey of (Z)-1-(3,3-difluoro-1-propan-2-ylcyclobutyl)-N'-methylethene-1,2-diamine?
The InChIKey is WHOUHJFFACOGLS-YWEYNIOJSA-N. The full InChI is InChI=1S/C10H18F2N2/c1-7(2)9(8(13)4-14-3)5-10(11,12)6-9/h4,7,14H,5-6,13H2,1-3H3/b8-4-.
What are the key properties of (Z)-1-(3,3-difluoro-1-propan-2-ylcyclobutyl)-N'-methylethene-1,2-diamine?
(Z)-1-(3,3-difluoro-1-propan-2-ylcyclobutyl)-N'-methylethene-1,2-diamine has a molecular weight of 204.26 g/mol, XLogP of 2.08, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-(3,3-difluoro-1-propan-2-ylcyclobutyl)-N'-methylethene-1,2-diamine is sourced from PubChem (CID 153188643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).