About (1-aminopyrazino[1,2-a]benzimidazol-3-yl)methanol
(1-aminopyrazino[1,2-a]benzimidazol-3-yl)methanol (PubChem CID 153199692) has the molecular formula C11H10N4O
and a molecular weight of 214.23 g/mol. Its IUPAC name is (1-aminopyrazino[1,2-a]benzimidazol-3-yl)methanol.
Molecular Properties
| Compound Name | (1-aminopyrazino[1,2-a]benzimidazol-3-yl)methanol |
| PubChem CID | 153199692 |
| Molecular Formula | C11H10N4O |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | (1-aminopyrazino[1,2-a]benzimidazol-3-yl)methanol |
| SMILES | Nc1nc(CO)cn2c1nc1ccccc12 |
| InChI | InChI=1S/C11H10N4O/c12-10-11-14-8-3-1-2-4-9(8)15(11)5-7(6-16)13-10/h1-5,16H,6H2,(H2,12,13) |
| InChIKey | WJRCPNMBNAPFCS-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1-aminopyrazino[1,2-a]benzimidazol-3-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-aminopyrazino[1,2-a]benzimidazol-3-yl)methanol?
The IUPAC name of (1-aminopyrazino[1,2-a]benzimidazol-3-yl)methanol (CID 153199692) is (1-aminopyrazino[1,2-a]benzimidazol-3-yl)methanol.
What is the SMILES notation for (1-aminopyrazino[1,2-a]benzimidazol-3-yl)methanol?
The canonical SMILES for (1-aminopyrazino[1,2-a]benzimidazol-3-yl)methanol is Nc1nc(CO)cn2c1nc1ccccc12.
What is the InChIKey of (1-aminopyrazino[1,2-a]benzimidazol-3-yl)methanol?
The InChIKey is WJRCPNMBNAPFCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N4O/c12-10-11-14-8-3-1-2-4-9(8)15(11)5-7(6-16)13-10/h1-5,16H,6H2,(H2,12,13).
What are the key properties of (1-aminopyrazino[1,2-a]benzimidazol-3-yl)methanol?
(1-aminopyrazino[1,2-a]benzimidazol-3-yl)methanol has a molecular weight of 214.23 g/mol, XLogP of 0.96, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-aminopyrazino[1,2-a]benzimidazol-3-yl)methanol is sourced from PubChem (CID 153199692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).