C10H9ClF3NOS — CID 153200125
3-[(Z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethylcyclopropane-1-carbonyl isothiocyanate (PubChem CID 153200125) has the molecular formula C10H9ClF3NOS and a molecular weight of 283.70 g/mol. Its IUPAC name is 3-[(Z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethylcyclopropane-1-carbonyl isothiocyanate.
| Compound Name | 3-[(Z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethylcyclopropane-1-carbonyl isothiocyanate |
|---|---|
| PubChem CID | 153200125 |
| Molecular Formula | C10H9ClF3NOS |
| Molecular Weight | 283.70 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | 3-[(Z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethylcyclopropane-1-carbonyl isothiocyanate |
| SMILES | CC1(C)C(/C=C(\Cl)C(F)(F)F)C1C(=O)N=C=S |
| InChI | InChI=1S/C10H9ClF3NOS/c1-9(2)5(3-6(11)10(12,13)14)7(9)8(16)15-4-17/h3,5,7H,1-2H3/b6-3- |
| InChIKey | WJTCZKCKAJAJLP-UTCJRWHESA-N |
| XLogP | 3.57 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.70 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|