C34H28S4 — CID 15320202
(1E,2S,7R,8E)-2,7,9,14-tetraphenyl-3,6,10,13-tetrathiatricyclo[6.6.0.02,7]tetradeca-1(14),8-diene (PubChem CID 15320202) has the molecular formula C34H28S4 and a molecular weight of 564.87 g/mol. Its IUPAC name is (1E,2S,7R,8E)-2,7,9,14-tetraphenyl-3,6,10,13-tetrathiatricyclo[6.6.0.02,7]tetradeca-1(14),8-diene.
| Compound Name | (1E,2S,7R,8E)-2,7,9,14-tetraphenyl-3,6,10,13-tetrathiatricyclo[6.6.0.02,7]tetradeca-1(14),8-diene |
|---|---|
| PubChem CID | 15320202 |
| Molecular Formula | C34H28S4 |
| Molecular Weight | 564.87 g/mol |
| Exact Mass | 564.11 |
| IUPAC Name | (1E,2S,7R,8E)-2,7,9,14-tetraphenyl-3,6,10,13-tetrathiatricyclo[6.6.0.02,7]tetradeca-1(14),8-diene |
| SMILES | c1ccc(/C2=C3C(=C(/c4ccccc4)SCCS2)/[C@@]2(c4ccccc4)SCCS[C@@]/32c2ccccc2)cc1 |
| InChI | InChI=1S/C34H28S4/c1-5-13-25(14-6-1)31-29-30(32(36-22-21-35-31)26-15-7-2-8-16-26)34(28-19-11-4-12-20-28)33(29,37-23-24-38-34)27-17-9-3-10-18-27/h1-20H,21-24H2/b31-29+,32-30+/t33-,34+ |
| InChIKey | CWOHXQHVZFESRK-QUFATCTRSA-N |
| XLogP | 9.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.87 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |