About 2-(2-bromophenyl)-1,3-dithiane
2-(2-bromophenyl)-1,3-dithiane (PubChem CID 15320278) has the molecular formula C10H11BrS2
and a molecular weight of 275.24 g/mol. Its IUPAC name is 2-(2-bromophenyl)-1,3-dithiane.
Molecular Properties
| Compound Name | 2-(2-bromophenyl)-1,3-dithiane |
| PubChem CID | 15320278 |
| Molecular Formula | C10H11BrS2 |
| Molecular Weight | 275.24 g/mol |
| Exact Mass | 273.95 |
| IUPAC Name | 2-(2-bromophenyl)-1,3-dithiane |
| SMILES | Brc1ccccc1C1SCCCS1 |
| InChI | InChI=1S/C10H11BrS2/c11-9-5-2-1-4-8(9)10-12-6-3-7-13-10/h1-2,4-5,10H,3,6-7H2 |
| InChIKey | DZEDCNZMBVQNRP-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.24 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2-bromophenyl)-1,3-dithiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-bromophenyl)-1,3-dithiane?
The IUPAC name of 2-(2-bromophenyl)-1,3-dithiane (CID 15320278) is 2-(2-bromophenyl)-1,3-dithiane.
What is the SMILES notation for 2-(2-bromophenyl)-1,3-dithiane?
The canonical SMILES for 2-(2-bromophenyl)-1,3-dithiane is Brc1ccccc1C1SCCCS1.
What is the InChIKey of 2-(2-bromophenyl)-1,3-dithiane?
The InChIKey is DZEDCNZMBVQNRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrS2/c11-9-5-2-1-4-8(9)10-12-6-3-7-13-10/h1-2,4-5,10H,3,6-7H2.
What are the key properties of 2-(2-bromophenyl)-1,3-dithiane?
2-(2-bromophenyl)-1,3-dithiane has a molecular weight of 275.24 g/mol, XLogP of 4.32, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-bromophenyl)-1,3-dithiane is sourced from PubChem (CID 15320278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).