About ethyl N-benzyl-N-[(2S,3R)-2-methyl-5-methylidene-6-oxooxan-3-yl]carbamate
ethyl N-benzyl-N-[(2S,3R)-2-methyl-5-methylidene-6-oxooxan-3-yl]carbamate (PubChem CID 15320793) has the molecular formula C17H21NO4
and a molecular weight of 303.36 g/mol. Its IUPAC name is ethyl N-benzyl-N-[(2S,3R)-2-methyl-5-methylidene-6-oxooxan-3-yl]carbamate.
Molecular Properties
| Compound Name | ethyl N-benzyl-N-[(2S,3R)-2-methyl-5-methylidene-6-oxooxan-3-yl]carbamate |
| PubChem CID | 15320793 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | ethyl N-benzyl-N-[(2S,3R)-2-methyl-5-methylidene-6-oxooxan-3-yl]carbamate |
| SMILES | C=C1C[C@@H](N(Cc2ccccc2)C(=O)OCC)[C@H](C)OC1=O |
| InChI | InChI=1S/C17H21NO4/c1-4-21-17(20)18(11-14-8-6-5-7-9-14)15-10-12(2)16(19)22-13(15)3/h5-9,13,15H,2,4,10-11H2,1,3H3/t13-,15+/m0/s1 |
| InChIKey | JTVDBQUSKIEVJX-DZGCQCFKSA-N |
| XLogP | 2.91 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-benzyl-N-[(2S,3R)-2-methyl-5-methylidene-6-oxooxan-3-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-benzyl-N-[(2S,3R)-2-methyl-5-methylidene-6-oxooxan-3-yl]carbamate?
The IUPAC name of ethyl N-benzyl-N-[(2S,3R)-2-methyl-5-methylidene-6-oxooxan-3-yl]carbamate (CID 15320793) is ethyl N-benzyl-N-[(2S,3R)-2-methyl-5-methylidene-6-oxooxan-3-yl]carbamate.
What is the SMILES notation for ethyl N-benzyl-N-[(2S,3R)-2-methyl-5-methylidene-6-oxooxan-3-yl]carbamate?
The canonical SMILES for ethyl N-benzyl-N-[(2S,3R)-2-methyl-5-methylidene-6-oxooxan-3-yl]carbamate is C=C1C[C@@H](N(Cc2ccccc2)C(=O)OCC)[C@H](C)OC1=O.
What is the InChIKey of ethyl N-benzyl-N-[(2S,3R)-2-methyl-5-methylidene-6-oxooxan-3-yl]carbamate?
The InChIKey is JTVDBQUSKIEVJX-DZGCQCFKSA-N. The full InChI is InChI=1S/C17H21NO4/c1-4-21-17(20)18(11-14-8-6-5-7-9-14)15-10-12(2)16(19)22-13(15)3/h5-9,13,15H,2,4,10-11H2,1,3H3/t13-,15+/m0/s1.
What are the key properties of ethyl N-benzyl-N-[(2S,3R)-2-methyl-5-methylidene-6-oxooxan-3-yl]carbamate?
ethyl N-benzyl-N-[(2S,3R)-2-methyl-5-methylidene-6-oxooxan-3-yl]carbamate has a molecular weight of 303.36 g/mol, XLogP of 2.91, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-benzyl-N-[(2S,3R)-2-methyl-5-methylidene-6-oxooxan-3-yl]carbamate is sourced from PubChem (CID 15320793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).