C9H7F4N2O5S2- — CID 153210041
2-[[2,3,5,6-tetrafluoro-4-(methylideneamino)phenyl]sulfonylamino]ethanesulfonate (PubChem CID 153210041) has the molecular formula C9H7F4N2O5S2- and a molecular weight of 363.29 g/mol. Its IUPAC name is 2-[[2,3,5,6-tetrafluoro-4-(methylideneamino)phenyl]sulfonylamino]ethanesulfonate.
| Compound Name | 2-[[2,3,5,6-tetrafluoro-4-(methylideneamino)phenyl]sulfonylamino]ethanesulfonate |
|---|---|
| PubChem CID | 153210041 |
| Molecular Formula | C9H7F4N2O5S2- |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 362.97 |
| IUPAC Name | 2-[[2,3,5,6-tetrafluoro-4-(methylideneamino)phenyl]sulfonylamino]ethanesulfonate |
| SMILES | C=Nc1c(F)c(F)c(S(=O)(=O)NCCS(=O)(=O)[O-])c(F)c1F |
| InChI | InChI=1S/C9H8F4N2O5S2/c1-14-8-4(10)6(12)9(7(13)5(8)11)22(19,20)15-2-3-21(16,17)18/h15H,1-3H2,(H,16,17,18)/p-1 |
| InChIKey | WLPMEHFOZWQLRM-UHFFFAOYSA-M |
| XLogP | 0.40 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|