C32H28F6N2O2 — CID 153210489
(3R,4S)-N-benzyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-4-(naphthalen-1-ylmethyl)pyrrolidine-1-carboxamide (PubChem CID 153210489) has the molecular formula C32H28F6N2O2 and a molecular weight of 586.58 g/mol. Its IUPAC name is (3R,4S)-N-benzyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-4-(naphthalen-1-ylmethyl)pyrrolidine-1-carboxamide.
| Compound Name | (3R,4S)-N-benzyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-4-(naphthalen-1-ylmethyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 153210489 |
| Molecular Formula | C32H28F6N2O2 |
| Molecular Weight | 586.58 g/mol |
| Exact Mass | 586.21 |
| IUPAC Name | (3R,4S)-N-benzyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-4-(naphthalen-1-ylmethyl)pyrrolidine-1-carboxamide |
| SMILES | O=C(NCc1ccccc1)N1C[C@@H](Cc2cccc3ccccc23)[C@H](c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C32H28F6N2O2/c33-31(34,35)30(42,32(36,37)38)26-15-13-23(14-16-26)28-20-40(29(41)39-18-21-7-2-1-3-8-21)19-25(28)17-24-11-6-10-22-9-4-5-12-27(22)24/h1-16,25,28,42H,17-20H2,(H,39,41)/t25-,28+/m1/s1 |
| InChIKey | WLRRMLKHPJFZRI-NAKRPHOHSA-N |
| XLogP | 7.32 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.58 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |