About 2-[(5-oxo-4,4-diphenyl-1H-imidazol-2-yl)sulfanyl]acetic acid
2-[(5-oxo-4,4-diphenyl-1H-imidazol-2-yl)sulfanyl]acetic acid (PubChem CID 15321057) has the molecular formula C17H14N2O3S
and a molecular weight of 326.38 g/mol. Its IUPAC name is 2-[(5-oxo-4,4-diphenyl-1H-imidazol-2-yl)sulfanyl]acetic acid.
Molecular Properties
| Compound Name | 2-[(5-oxo-4,4-diphenyl-1H-imidazol-2-yl)sulfanyl]acetic acid |
| PubChem CID | 15321057 |
| Molecular Formula | C17H14N2O3S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 2-[(5-oxo-4,4-diphenyl-1H-imidazol-2-yl)sulfanyl]acetic acid |
| SMILES | O=C(O)CSC1=NC(c2ccccc2)(c2ccccc2)C(=O)N1 |
| InChI | InChI=1S/C17H14N2O3S/c20-14(21)11-23-16-18-15(22)17(19-16,12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10H,11H2,(H,20,21)(H,18,19,22) |
| InChIKey | DBDBICPCSZOXRQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(5-oxo-4,4-diphenyl-1H-imidazol-2-yl)sulfanyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-oxo-4,4-diphenyl-1H-imidazol-2-yl)sulfanyl]acetic acid?
The IUPAC name of 2-[(5-oxo-4,4-diphenyl-1H-imidazol-2-yl)sulfanyl]acetic acid (CID 15321057) is 2-[(5-oxo-4,4-diphenyl-1H-imidazol-2-yl)sulfanyl]acetic acid.
What is the SMILES notation for 2-[(5-oxo-4,4-diphenyl-1H-imidazol-2-yl)sulfanyl]acetic acid?
The canonical SMILES for 2-[(5-oxo-4,4-diphenyl-1H-imidazol-2-yl)sulfanyl]acetic acid is O=C(O)CSC1=NC(c2ccccc2)(c2ccccc2)C(=O)N1.
What is the InChIKey of 2-[(5-oxo-4,4-diphenyl-1H-imidazol-2-yl)sulfanyl]acetic acid?
The InChIKey is DBDBICPCSZOXRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2O3S/c20-14(21)11-23-16-18-15(22)17(19-16,12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10H,11H2,(H,20,21)(H,18,19,22).
What are the key properties of 2-[(5-oxo-4,4-diphenyl-1H-imidazol-2-yl)sulfanyl]acetic acid?
2-[(5-oxo-4,4-diphenyl-1H-imidazol-2-yl)sulfanyl]acetic acid has a molecular weight of 326.38 g/mol, XLogP of 2.23, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-oxo-4,4-diphenyl-1H-imidazol-2-yl)sulfanyl]acetic acid is sourced from PubChem (CID 15321057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).