About 2-(6-methyl-2,1,3-benzothiadiazol-4-yl)acetonitrile
2-(6-methyl-2,1,3-benzothiadiazol-4-yl)acetonitrile (PubChem CID 153212013) has the molecular formula C9H7N3S
and a molecular weight of 189.24 g/mol. Its IUPAC name is 2-(6-methyl-2,1,3-benzothiadiazol-4-yl)acetonitrile.
Molecular Properties
| Compound Name | 2-(6-methyl-2,1,3-benzothiadiazol-4-yl)acetonitrile |
| PubChem CID | 153212013 |
| Molecular Formula | C9H7N3S |
| Molecular Weight | 189.24 g/mol |
| Exact Mass | 189.04 |
| IUPAC Name | 2-(6-methyl-2,1,3-benzothiadiazol-4-yl)acetonitrile |
| SMILES | Cc1cc(CC#N)c2nsnc2c1 |
| InChI | InChI=1S/C9H7N3S/c1-6-4-7(2-3-10)9-8(5-6)11-13-12-9/h4-5H,2H2,1H3 |
| InChIKey | WLZFIQSWDIFDHW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.24 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(6-methyl-2,1,3-benzothiadiazol-4-yl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-methyl-2,1,3-benzothiadiazol-4-yl)acetonitrile?
The IUPAC name of 2-(6-methyl-2,1,3-benzothiadiazol-4-yl)acetonitrile (CID 153212013) is 2-(6-methyl-2,1,3-benzothiadiazol-4-yl)acetonitrile.
What is the SMILES notation for 2-(6-methyl-2,1,3-benzothiadiazol-4-yl)acetonitrile?
The canonical SMILES for 2-(6-methyl-2,1,3-benzothiadiazol-4-yl)acetonitrile is Cc1cc(CC#N)c2nsnc2c1.
What is the InChIKey of 2-(6-methyl-2,1,3-benzothiadiazol-4-yl)acetonitrile?
The InChIKey is WLZFIQSWDIFDHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3S/c1-6-4-7(2-3-10)9-8(5-6)11-13-12-9/h4-5H,2H2,1H3.
What are the key properties of 2-(6-methyl-2,1,3-benzothiadiazol-4-yl)acetonitrile?
2-(6-methyl-2,1,3-benzothiadiazol-4-yl)acetonitrile has a molecular weight of 189.24 g/mol, XLogP of 2.07, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-methyl-2,1,3-benzothiadiazol-4-yl)acetonitrile is sourced from PubChem (CID 153212013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).