About N-(2-methyl-5,8-dioxoquinolin-6-yl)acetamide
N-(2-methyl-5,8-dioxoquinolin-6-yl)acetamide (PubChem CID 15321227) has the molecular formula C12H10N2O3
and a molecular weight of 230.22 g/mol. Its IUPAC name is N-(2-methyl-5,8-dioxoquinolin-6-yl)acetamide.
Molecular Properties
| Compound Name | N-(2-methyl-5,8-dioxoquinolin-6-yl)acetamide |
| PubChem CID | 15321227 |
| Molecular Formula | C12H10N2O3 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | N-(2-methyl-5,8-dioxoquinolin-6-yl)acetamide |
| SMILES | CC(=O)NC1=CC(=O)c2nc(C)ccc2C1=O |
| InChI | InChI=1S/C12H10N2O3/c1-6-3-4-8-11(13-6)10(16)5-9(12(8)17)14-7(2)15/h3-5H,1-2H3,(H,14,15) |
| InChIKey | VFWLJRXGIGEBCC-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methyl-5,8-dioxoquinolin-6-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methyl-5,8-dioxoquinolin-6-yl)acetamide?
The IUPAC name of N-(2-methyl-5,8-dioxoquinolin-6-yl)acetamide (CID 15321227) is N-(2-methyl-5,8-dioxoquinolin-6-yl)acetamide.
What is the SMILES notation for N-(2-methyl-5,8-dioxoquinolin-6-yl)acetamide?
The canonical SMILES for N-(2-methyl-5,8-dioxoquinolin-6-yl)acetamide is CC(=O)NC1=CC(=O)c2nc(C)ccc2C1=O.
What is the InChIKey of N-(2-methyl-5,8-dioxoquinolin-6-yl)acetamide?
The InChIKey is VFWLJRXGIGEBCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O3/c1-6-3-4-8-11(13-6)10(16)5-9(12(8)17)14-7(2)15/h3-5H,1-2H3,(H,14,15).
What are the key properties of N-(2-methyl-5,8-dioxoquinolin-6-yl)acetamide?
N-(2-methyl-5,8-dioxoquinolin-6-yl)acetamide has a molecular weight of 230.22 g/mol, XLogP of 0.79, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methyl-5,8-dioxoquinolin-6-yl)acetamide is sourced from PubChem (CID 15321227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).