C12H20F5N2O+ — CID 15321239
[(E)-3-(diethylamino)-2-(2,2,3,3,3-pentafluoropropoxy)prop-2-enylidene]-dimethylazanium (PubChem CID 15321239) has the molecular formula C12H20F5N2O+ and a molecular weight of 303.30 g/mol. Its IUPAC name is [(E)-3-(diethylamino)-2-(2,2,3,3,3-pentafluoropropoxy)prop-2-enylidene]-dimethylazanium.
| Compound Name | [(E)-3-(diethylamino)-2-(2,2,3,3,3-pentafluoropropoxy)prop-2-enylidene]-dimethylazanium |
|---|---|
| PubChem CID | 15321239 |
| Molecular Formula | C12H20F5N2O+ |
| Molecular Weight | 303.30 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | [(E)-3-(diethylamino)-2-(2,2,3,3,3-pentafluoropropoxy)prop-2-enylidene]-dimethylazanium |
| SMILES | CCN(/C=C(\C=[N+](C)C)OCC(F)(F)C(F)(F)F)CC |
| InChI | InChI=1S/C12H20F5N2O/c1-5-19(6-2)8-10(7-18(3)4)20-9-11(13,14)12(15,16)17/h7-8H,5-6,9H2,1-4H3/q+1 |
| InChIKey | UDQSQNHTCCANPW-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 15.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.30 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|