C19H12F8S — CID 15321296
16-(1,1,2,2,3,3,4,4-octafluorobutyl)-15-thiatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene (PubChem CID 15321296) has the molecular formula C19H12F8S and a molecular weight of 424.36 g/mol. Its IUPAC name is 16-(1,1,2,2,3,3,4,4-octafluorobutyl)-15-thiatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene.
| Compound Name | 16-(1,1,2,2,3,3,4,4-octafluorobutyl)-15-thiatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene |
|---|---|
| PubChem CID | 15321296 |
| Molecular Formula | C19H12F8S |
| Molecular Weight | 424.36 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | 16-(1,1,2,2,3,3,4,4-octafluorobutyl)-15-thiatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)C1SC2c3ccccc3C1c1ccccc12 |
| InChI | InChI=1S/C19H12F8S/c20-16(21)18(24,25)19(26,27)17(22,23)15-13-9-5-1-3-7-11(9)14(28-15)12-8-4-2-6-10(12)13/h1-8,13-16H |
| InChIKey | VJSVTCLWDXVLGI-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.36 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|